About ethyl 3-[4,5-bis(ethenyl)-1H-pyrrol-3-yl]-3-(1H-indol-6-yl)propanoate
ethyl 3-[4,5-bis(ethenyl)-1H-pyrrol-3-yl]-3-(1H-indol-6-yl)propanoate (PubChem CID 143475478) has the molecular formula C21H22N2O2
and a molecular weight of 334.42 g/mol. Its IUPAC name is ethyl 3-[4,5-bis(ethenyl)-1H-pyrrol-3-yl]-3-(1H-indol-6-yl)propanoate.
Molecular Properties
| Compound Name | ethyl 3-[4,5-bis(ethenyl)-1H-pyrrol-3-yl]-3-(1H-indol-6-yl)propanoate |
| PubChem CID | 143475478 |
| Molecular Formula | C21H22N2O2 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.17 |
| IUPAC Name | ethyl 3-[4,5-bis(ethenyl)-1H-pyrrol-3-yl]-3-(1H-indol-6-yl)propanoate |
| SMILES | C=Cc1[nH]cc(C(CC(=O)OCC)c2ccc3cc[nH]c3c2)c1C=C |
| InChI | InChI=1S/C21H22N2O2/c1-4-16-18(13-23-19(16)5-2)17(12-21(24)25-6-3)15-8-7-14-9-10-22-20(14)11-15/h4-5,7-11,13,17,22-23H,1-2,6,12H2,3H3 |
| InChIKey | GMQWBOKGNAKJID-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 57.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethyl 3-[4,5-bis(ethenyl)-1H-pyrrol-3-yl]-3-(1H-indol-6-yl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-[4,5-bis(ethenyl)-1H-pyrrol-3-yl]-3-(1H-indol-6-yl)propanoate?
The IUPAC name of ethyl 3-[4,5-bis(ethenyl)-1H-pyrrol-3-yl]-3-(1H-indol-6-yl)propanoate (CID 143475478) is ethyl 3-[4,5-bis(ethenyl)-1H-pyrrol-3-yl]-3-(1H-indol-6-yl)propanoate.
What is the SMILES notation for ethyl 3-[4,5-bis(ethenyl)-1H-pyrrol-3-yl]-3-(1H-indol-6-yl)propanoate?
The canonical SMILES for ethyl 3-[4,5-bis(ethenyl)-1H-pyrrol-3-yl]-3-(1H-indol-6-yl)propanoate is C=Cc1[nH]cc(C(CC(=O)OCC)c2ccc3cc[nH]c3c2)c1C=C.
What is the InChIKey of ethyl 3-[4,5-bis(ethenyl)-1H-pyrrol-3-yl]-3-(1H-indol-6-yl)propanoate?
The InChIKey is GMQWBOKGNAKJID-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22N2O2/c1-4-16-18(13-23-19(16)5-2)17(12-21(24)25-6-3)15-8-7-14-9-10-22-20(14)11-15/h4-5,7-11,13,17,22-23H,1-2,6,12H2,3H3.
What are the key properties of ethyl 3-[4,5-bis(ethenyl)-1H-pyrrol-3-yl]-3-(1H-indol-6-yl)propanoate?
ethyl 3-[4,5-bis(ethenyl)-1H-pyrrol-3-yl]-3-(1H-indol-6-yl)propanoate has a molecular weight of 334.42 g/mol, XLogP of 4.87, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-[4,5-bis(ethenyl)-1H-pyrrol-3-yl]-3-(1H-indol-6-yl)propanoate is sourced from PubChem (CID 143475478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).