C21H22N2O2 — CID 143475478
ethyl 3-[4,5-bis(ethenyl)-1H-pyrrol-3-yl]-3-(1H-indol-6-yl)propanoate (PubChem CID 143475478) has the molecular formula C21H22N2O2 and a molecular weight of 334.42 g/mol. Its IUPAC name is ethyl 3-[4,5-bis(ethenyl)-1H-pyrrol-3-yl]-3-(1H-indol-6-yl)propanoate.
| Compound Name | ethyl 3-[4,5-bis(ethenyl)-1H-pyrrol-3-yl]-3-(1H-indol-6-yl)propanoate |
|---|---|
| PubChem CID | 143475478 |
| Molecular Formula | C21H22N2O2 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.17 |
| IUPAC Name | ethyl 3-[4,5-bis(ethenyl)-1H-pyrrol-3-yl]-3-(1H-indol-6-yl)propanoate |
| SMILES | C=Cc1[nH]cc(C(CC(=O)OCC)c2ccc3cc[nH]c3c2)c1C=C |
| InChI | InChI=1S/C21H22N2O2/c1-4-16-18(13-23-19(16)5-2)17(12-21(24)25-6-3)15-8-7-14-9-10-22-20(14)11-15/h4-5,7-11,13,17,22-23H,1-2,6,12H2,3H3 |
| InChIKey | GMQWBOKGNAKJID-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 57.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |