C21H25N3O5 — CID 143475579
dimethyl 2-[(4-methoxy-1H-pyrrolo[2,3-b]pyridin-3-yl)-pyridin-3-ylmethyl]propanedioate;ethane (PubChem CID 143475579) has the molecular formula C21H25N3O5 and a molecular weight of 399.45 g/mol. Its IUPAC name is dimethyl 2-[(4-methoxy-1H-pyrrolo[2,3-b]pyridin-3-yl)-pyridin-3-ylmethyl]propanedioate;ethane.
| Compound Name | dimethyl 2-[(4-methoxy-1H-pyrrolo[2,3-b]pyridin-3-yl)-pyridin-3-ylmethyl]propanedioate;ethane |
|---|---|
| PubChem CID | 143475579 |
| Molecular Formula | C21H25N3O5 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | dimethyl 2-[(4-methoxy-1H-pyrrolo[2,3-b]pyridin-3-yl)-pyridin-3-ylmethyl]propanedioate;ethane |
| SMILES | CC.COC(=O)C(C(=O)OC)C(c1cccnc1)c1c[nH]c2nccc(OC)c12 |
| InChI | InChI=1S/C19H19N3O5.C2H6/c1-25-13-6-8-21-17-15(13)12(10-22-17)14(11-5-4-7-20-9-11)16(18(23)26-2)19(24)27-3;1-2/h4-10,14,16H,1-3H3,(H,21,22);1-2H3 |
| InChIKey | NELWXICCOJUMPI-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|