C23H20N4O2 — CID 155533282
(E)-3-[3-(4-methoxyphenyl)-1H-pyrrolo[2,3-b]pyridin-5-yl]-N-(pyridin-4-ylmethyl)prop-2-enamide (PubChem CID 155533282) has the molecular formula C23H20N4O2 and a molecular weight of 384.40 g/mol. Its IUPAC name is (E)-3-[3-(4-methoxyphenyl)-1H-pyrrolo[2,3-b]pyridin-5-yl]-N-(pyridin-4-ylmethyl)prop-2-enamide.
| Compound Name | (E)-3-[3-(4-methoxyphenyl)-1H-pyrrolo[2,3-b]pyridin-5-yl]-N-(pyridin-4-ylmethyl)prop-2-enamide |
|---|---|
| PubChem CID | 155533282 |
| Molecular Formula | C23H20N4O2 |
| Molecular Weight | 384.40 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | (E)-3-[3-(4-methoxyphenyl)-1H-pyrrolo[2,3-b]pyridin-5-yl]-N-(pyridin-4-ylmethyl)prop-2-enamide |
| SMILES | COC1=CC=C(C=C1)C2=CNC3=C2C=C(C=N3)/C=C/C(=O)NCC4=CC=NC=C4 |
| InChI | InChI=1S/C23H20N4O2/c1-29-19-5-3-18(4-6-19)21-15-27-23-20(21)12-17(14-26-23)2-7-22(28)25-13-16-8-10-24-11-9-16/h2-12,14-15H,13H2,1H3,(H,25,28)(H,26,27)/b7-2+ |
| InChIKey | YPAITSINMJTFDT-FARCUNLSSA-N |
| XLogP | 3.00 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | 555 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.40 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|