C14H20ClNO2 — CID 143476132
4-[(4-chlorophenyl)methyl-methylamino]-6-methyloxan-2-ol (PubChem CID 143476132) has the molecular formula C14H20ClNO2 and a molecular weight of 269.77 g/mol. Its IUPAC name is 4-[(4-chlorophenyl)methyl-methylamino]-6-methyloxan-2-ol.
| Compound Name | 4-[(4-chlorophenyl)methyl-methylamino]-6-methyloxan-2-ol |
|---|---|
| PubChem CID | 143476132 |
| Molecular Formula | C14H20ClNO2 |
| Molecular Weight | 269.77 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | 4-[(4-chlorophenyl)methyl-methylamino]-6-methyloxan-2-ol |
| SMILES | CC1CC(N(C)Cc2ccc(Cl)cc2)CC(O)O1 |
| InChI | InChI=1S/C14H20ClNO2/c1-10-7-13(8-14(17)18-10)16(2)9-11-3-5-12(15)6-4-11/h3-6,10,13-14,17H,7-9H2,1-2H3 |
| InChIKey | ZUKKMKUVXWCBIL-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.77 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |