C27H23FN4O2 — CID 1434766
N-benzyl-N-[(1S)-2-(4-fluoroanilino)-1-(2-methylphenyl)-2-oxoethyl]pyrazine-2-carboxamide (PubChem CID 1434766) has the molecular formula C27H23FN4O2 and a molecular weight of 454.51 g/mol. Its IUPAC name is N-benzyl-N-[(1S)-2-(4-fluoroanilino)-1-(2-methylphenyl)-2-oxoethyl]pyrazine-2-carboxamide.
| Compound Name | N-benzyl-N-[(1S)-2-(4-fluoroanilino)-1-(2-methylphenyl)-2-oxoethyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 1434766 |
| Molecular Formula | C27H23FN4O2 |
| Molecular Weight | 454.51 g/mol |
| Exact Mass | 454.18 |
| IUPAC Name | N-benzyl-N-[(1S)-2-(4-fluoroanilino)-1-(2-methylphenyl)-2-oxoethyl]pyrazine-2-carboxamide |
| SMILES | Cc1ccccc1[C@@H](C(=O)Nc1ccc(F)cc1)N(Cc1ccccc1)C(=O)c1cnccn1 |
| InChI | InChI=1S/C27H23FN4O2/c1-19-7-5-6-10-23(19)25(26(33)31-22-13-11-21(28)12-14-22)32(18-20-8-3-2-4-9-20)27(34)24-17-29-15-16-30-24/h2-17,25H,18H2,1H3,(H,31,33)/t25-/m0/s1 |
| InChIKey | BSUADAPYHKYVKZ-VWLOTQADSA-N |
| XLogP | 4.95 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.51 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |