C28H25FN4O3 — CID 3202118
N-benzyl-N-[1-(4-ethoxyphenyl)-2-(4-fluoroanilino)-2-oxoethyl]pyrazine-2-carboxamide (PubChem CID 3202118) has the molecular formula C28H25FN4O3 and a molecular weight of 484.53 g/mol. Its IUPAC name is N-benzyl-N-[1-(4-ethoxyphenyl)-2-(4-fluoroanilino)-2-oxoethyl]pyrazine-2-carboxamide.
| Compound Name | N-benzyl-N-[1-(4-ethoxyphenyl)-2-(4-fluoroanilino)-2-oxoethyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 3202118 |
| Molecular Formula | C28H25FN4O3 |
| Molecular Weight | 484.53 g/mol |
| Exact Mass | 484.19 |
| IUPAC Name | N-benzyl-N-[1-(4-ethoxyphenyl)-2-(4-fluoroanilino)-2-oxoethyl]pyrazine-2-carboxamide |
| SMILES | CCOc1ccc(C(C(=O)Nc2ccc(F)cc2)N(Cc2ccccc2)C(=O)c2cnccn2)cc1 |
| InChI | InChI=1S/C28H25FN4O3/c1-2-36-24-14-8-21(9-15-24)26(27(34)32-23-12-10-22(29)11-13-23)33(19-20-6-4-3-5-7-20)28(35)25-18-30-16-17-31-25/h3-18,26H,2,19H2,1H3,(H,32,34) |
| InChIKey | YVDPEWGGMYNPAT-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.53 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |