C10H14N2 — CID 143477369
(2E)-1,4,6-trimethyl-2-prop-2-enylidenepyrimidine (PubChem CID 143477369) has the molecular formula C10H14N2 and a molecular weight of 162.24 g/mol. Its IUPAC name is (2E)-1,4,6-trimethyl-2-prop-2-enylidenepyrimidine.
| Compound Name | (2E)-1,4,6-trimethyl-2-prop-2-enylidenepyrimidine |
|---|---|
| PubChem CID | 143477369 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | (2E)-1,4,6-trimethyl-2-prop-2-enylidenepyrimidine |
| SMILES | C=C/C=C1/N=C(C)C=C(C)N1C |
| InChI | InChI=1S/C10H14N2/c1-5-6-10-11-8(2)7-9(3)12(10)4/h5-7H,1H2,2-4H3/b10-6- |
| InChIKey | CIWSMXQUUZZWPL-POHAHGRESA-N |
| XLogP | 2.32 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |