C14H20N4 — CID 143477771
N-propan-2-yl-1,4,6-triazatricyclo[7.5.0.02,7]tetradeca-2(7),3,5,8-tetraen-3-amine (PubChem CID 143477771) has the molecular formula C14H20N4 and a molecular weight of 244.34 g/mol. Its IUPAC name is N-propan-2-yl-1,4,6-triazatricyclo[7.5.0.02,7]tetradeca-2(7),3,5,8-tetraen-3-amine.
| Compound Name | N-propan-2-yl-1,4,6-triazatricyclo[7.5.0.02,7]tetradeca-2(7),3,5,8-tetraen-3-amine |
|---|---|
| PubChem CID | 143477771 |
| Molecular Formula | C14H20N4 |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.17 |
| IUPAC Name | N-propan-2-yl-1,4,6-triazatricyclo[7.5.0.02,7]tetradeca-2(7),3,5,8-tetraen-3-amine |
| SMILES | CC(C)Nc1ncnc2cc3n(c12)CCCCC3 |
| InChI | InChI=1S/C14H20N4/c1-10(2)17-14-13-12(15-9-16-14)8-11-6-4-3-5-7-18(11)13/h8-10H,3-7H2,1-2H3,(H,15,16,17) |
| InChIKey | GGQLWJLIKQKNCR-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |