C8H15N5 — CID 19134968
6-N-methyl-4-N-propan-2-ylpyrimidine-4,5,6-triamine (PubChem CID 19134968) has the molecular formula C8H15N5 and a molecular weight of 181.24 g/mol. Its IUPAC name is 6-N-methyl-4-N-propan-2-ylpyrimidine-4,5,6-triamine.
| Compound Name | 6-N-methyl-4-N-propan-2-ylpyrimidine-4,5,6-triamine |
|---|---|
| PubChem CID | 19134968 |
| Molecular Formula | C8H15N5 |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.13 |
| IUPAC Name | 6-N-methyl-4-N-propan-2-ylpyrimidine-4,5,6-triamine |
| SMILES | CNc1ncnc(NC(C)C)c1N |
| InChI | InChI=1S/C8H15N5/c1-5(2)13-8-6(9)7(10-3)11-4-12-8/h4-5H,9H2,1-3H3,(H2,10,11,12,13) |
| InChIKey | YRFMQLMKEYOPFH-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |