C21H31N3O5 — CID 143478481
(3R)-2,3-dihydroxy-4-oxo-N-(2-phenoxyethyl)-4-[(2S)-2-(pyrrolidin-1-ylmethyl)pyrrolidin-1-yl]butanamide (PubChem CID 143478481) has the molecular formula C21H31N3O5 and a molecular weight of 405.50 g/mol. Its IUPAC name is (3R)-2,3-dihydroxy-4-oxo-N-(2-phenoxyethyl)-4-[(2S)-2-(pyrrolidin-1-ylmethyl)pyrrolidin-1-yl]butanamide.
| Compound Name | (3R)-2,3-dihydroxy-4-oxo-N-(2-phenoxyethyl)-4-[(2S)-2-(pyrrolidin-1-ylmethyl)pyrrolidin-1-yl]butanamide |
|---|---|
| PubChem CID | 143478481 |
| Molecular Formula | C21H31N3O5 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.23 |
| IUPAC Name | (3R)-2,3-dihydroxy-4-oxo-N-(2-phenoxyethyl)-4-[(2S)-2-(pyrrolidin-1-ylmethyl)pyrrolidin-1-yl]butanamide |
| SMILES | O=C(NCCOc1ccccc1)C(O)[C@@H](O)C(=O)N1CCC[C@H]1CN1CCCC1 |
| InChI | InChI=1S/C21H31N3O5/c25-18(20(27)22-10-14-29-17-8-2-1-3-9-17)19(26)21(28)24-13-6-7-16(24)15-23-11-4-5-12-23/h1-3,8-9,16,18-19,25-26H,4-7,10-15H2,(H,22,27)/t16-,18?,19+/m0/s1 |
| InChIKey | HVDHGMDIHPAHIT-DDPXNHEPSA-N |
| XLogP | -0.01 |
| TPSA | 102.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|