C25H30N2O4 — CID 150165105
2-[4-[(2S)-2-(pyrrolidin-1-ylmethyl)pyrrolidine-1-carbonyl]phenoxy]ethyl benzoate (PubChem CID 150165105) has the molecular formula C25H30N2O4 and a molecular weight of 422.53 g/mol. Its IUPAC name is 2-[4-[(2S)-2-(pyrrolidin-1-ylmethyl)pyrrolidine-1-carbonyl]phenoxy]ethyl benzoate.
| Compound Name | 2-[4-[(2S)-2-(pyrrolidin-1-ylmethyl)pyrrolidine-1-carbonyl]phenoxy]ethyl benzoate |
|---|---|
| PubChem CID | 150165105 |
| Molecular Formula | C25H30N2O4 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.22 |
| IUPAC Name | 2-[4-[(2S)-2-(pyrrolidin-1-ylmethyl)pyrrolidine-1-carbonyl]phenoxy]ethyl benzoate |
| SMILES | O=C(OCCOc1ccc(C(=O)N2CCC[C@H]2CN2CCCC2)cc1)c1ccccc1 |
| InChI | InChI=1S/C25H30N2O4/c28-24(27-16-6-9-22(27)19-26-14-4-5-15-26)20-10-12-23(13-11-20)30-17-18-31-25(29)21-7-2-1-3-8-21/h1-3,7-8,10-13,22H,4-6,9,14-19H2/t22-/m0/s1 |
| InChIKey | FIGAVMCEGNAVSB-QFIPXVFZSA-N |
| XLogP | 3.62 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|