C22H30F4N2O4 — CID 11960425
[4-(4-fluorobutoxy)phenyl]-[(2S)-2-(pyrrolidin-1-ylmethyl)pyrrolidin-1-yl]methanone;2,2,2-trifluoroacetic acid (PubChem CID 11960425) has the molecular formula C22H30F4N2O4 and a molecular weight of 462.48 g/mol. Its IUPAC name is [4-(4-fluorobutoxy)phenyl]-[(2S)-2-(pyrrolidin-1-ylmethyl)pyrrolidin-1-yl]methanone;2,2,2-trifluoroacetic acid.
| Compound Name | [4-(4-fluorobutoxy)phenyl]-[(2S)-2-(pyrrolidin-1-ylmethyl)pyrrolidin-1-yl]methanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 11960425 |
| Molecular Formula | C22H30F4N2O4 |
| Molecular Weight | 462.48 g/mol |
| Exact Mass | 462.21 |
| IUPAC Name | [4-(4-fluorobutoxy)phenyl]-[(2S)-2-(pyrrolidin-1-ylmethyl)pyrrolidin-1-yl]methanone;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C(c1ccc(OCCCCF)cc1)N1CCC[C@H]1CN1CCCC1 |
| InChI | InChI=1S/C20H29FN2O2.C2HF3O2/c21-11-1-4-15-25-19-9-7-17(8-10-19)20(24)23-14-5-6-18(23)16-22-12-2-3-13-22;3-2(4,5)1(6)7/h7-10,18H,1-6,11-16H2;(H,6,7)/t18-;/m0./s1 |
| InChIKey | ZCEIAEUVCGWEFL-FERBBOLQSA-N |
| XLogP | 4.15 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.48 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|