C20H27F3N2O2 — CID 11960424
[(2S)-2-(pyrrolidin-1-ylmethyl)pyrrolidin-1-yl]-[4-(4,4,4-trifluorobutoxy)phenyl]methanone (PubChem CID 11960424) has the molecular formula C20H27F3N2O2 and a molecular weight of 384.44 g/mol. Its IUPAC name is [(2S)-2-(pyrrolidin-1-ylmethyl)pyrrolidin-1-yl]-[4-(4,4,4-trifluorobutoxy)phenyl]methanone.
| Compound Name | [(2S)-2-(pyrrolidin-1-ylmethyl)pyrrolidin-1-yl]-[4-(4,4,4-trifluorobutoxy)phenyl]methanone |
|---|---|
| PubChem CID | 11960424 |
| Molecular Formula | C20H27F3N2O2 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | [(2S)-2-(pyrrolidin-1-ylmethyl)pyrrolidin-1-yl]-[4-(4,4,4-trifluorobutoxy)phenyl]methanone |
| SMILES | O=C(c1ccc(OCCCC(F)(F)F)cc1)N1CCC[C@H]1CN1CCCC1 |
| InChI | InChI=1S/C20H27F3N2O2/c21-20(22,23)10-4-14-27-18-8-6-16(7-9-18)19(26)25-13-3-5-17(25)15-24-11-1-2-12-24/h6-9,17H,1-5,10-15H2/t17-/m0/s1 |
| InChIKey | VDROVJDNOAAKFO-KRWDZBQOSA-N |
| XLogP | 4.11 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|