C26H36ClN3O2 — CID 143478503
N-(3-chloropropyl)-3-hydroxy-2-methyl-4-(4-phenylpiperazin-1-yl)pent-4-enamide;toluene (PubChem CID 143478503) has the molecular formula C26H36ClN3O2 and a molecular weight of 458.05 g/mol. Its IUPAC name is N-(3-chloropropyl)-3-hydroxy-2-methyl-4-(4-phenylpiperazin-1-yl)pent-4-enamide;toluene.
| Compound Name | N-(3-chloropropyl)-3-hydroxy-2-methyl-4-(4-phenylpiperazin-1-yl)pent-4-enamide;toluene |
|---|---|
| PubChem CID | 143478503 |
| Molecular Formula | C26H36ClN3O2 |
| Molecular Weight | 458.05 g/mol |
| Exact Mass | 457.25 |
| IUPAC Name | N-(3-chloropropyl)-3-hydroxy-2-methyl-4-(4-phenylpiperazin-1-yl)pent-4-enamide;toluene |
| SMILES | C=C(C(O)C(C)C(=O)NCCCCl)N1CCN(c2ccccc2)CC1.Cc1ccccc1 |
| InChI | InChI=1S/C19H28ClN3O2.C7H8/c1-15(19(25)21-10-6-9-20)18(24)16(2)22-11-13-23(14-12-22)17-7-4-3-5-8-17;1-7-5-3-2-4-6-7/h3-5,7-8,15,18,24H,2,6,9-14H2,1H3,(H,21,25);2-6H,1H3 |
| InChIKey | WCEOJMXNOYRJOS-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.05 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|