C16H27N3 — CID 143478721
(2E)-2-[(E)-1-[4-(aminomethyl)piperidin-1-yl]prop-1-enyl]penta-2,4-dienenitrile;ethane (PubChem CID 143478721) has the molecular formula C16H27N3 and a molecular weight of 261.41 g/mol. Its IUPAC name is (2E)-2-[(E)-1-[4-(aminomethyl)piperidin-1-yl]prop-1-enyl]penta-2,4-dienenitrile;ethane.
| Compound Name | (2E)-2-[(E)-1-[4-(aminomethyl)piperidin-1-yl]prop-1-enyl]penta-2,4-dienenitrile;ethane |
|---|---|
| PubChem CID | 143478721 |
| Molecular Formula | C16H27N3 |
| Molecular Weight | 261.41 g/mol |
| Exact Mass | 261.22 |
| IUPAC Name | (2E)-2-[(E)-1-[4-(aminomethyl)piperidin-1-yl]prop-1-enyl]penta-2,4-dienenitrile;ethane |
| SMILES | C=C/C=C(C#N)\C(=C/C)N1CCC(CN)CC1.CC |
| InChI | InChI=1S/C14H21N3.C2H6/c1-3-5-13(11-16)14(4-2)17-8-6-12(10-15)7-9-17;1-2/h3-5,12H,1,6-10,15H2,2H3;1-2H3/b13-5-,14-4+; |
| InChIKey | PASNCEKFCWSLOJ-AJUYIYPOSA-N |
| XLogP | 3.22 |
| TPSA | 53.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.41 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|