C10H18FN — CID 143478785
5-fluoro-N,N,3,4-tetramethylhexa-1,5-dien-2-amine (PubChem CID 143478785) has the molecular formula C10H18FN and a molecular weight of 171.26 g/mol. Its IUPAC name is 5-fluoro-N,N,3,4-tetramethylhexa-1,5-dien-2-amine.
| Compound Name | 5-fluoro-N,N,3,4-tetramethylhexa-1,5-dien-2-amine |
|---|---|
| PubChem CID | 143478785 |
| Molecular Formula | C10H18FN |
| Molecular Weight | 171.26 g/mol |
| Exact Mass | 171.14 |
| IUPAC Name | 5-fluoro-N,N,3,4-tetramethylhexa-1,5-dien-2-amine |
| SMILES | C=C(F)C(C)C(C)C(=C)N(C)C |
| InChI | InChI=1S/C10H18FN/c1-7(9(3)11)8(2)10(4)12(5)6/h7-8H,3-4H2,1-2,5-6H3 |
| InChIKey | OYXBUUYVXHVUQU-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.26 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |