C32H46ClN3O4S — CID 143479002
(3R)-4-[4-(2-chlorophenyl)piperazin-1-yl]-2,3-dihydroxy-N-[2-[4-[(4Z)-3-methylnona-4,8-dienyl]thiophen-2-yl]ethyl]-4-oxobutanamide;ethane (PubChem CID 143479002) has the molecular formula C32H46ClN3O4S and a molecular weight of 604.26 g/mol. Its IUPAC name is (3R)-4-[4-(2-chlorophenyl)piperazin-1-yl]-2,3-dihydroxy-N-[2-[4-[(4Z)-3-methylnona-4,8-dienyl]thiophen-2-yl]ethyl]-4-oxobutanamide;ethane.
| Compound Name | (3R)-4-[4-(2-chlorophenyl)piperazin-1-yl]-2,3-dihydroxy-N-[2-[4-[(4Z)-3-methylnona-4,8-dienyl]thiophen-2-yl]ethyl]-4-oxobutanamide;ethane |
|---|---|
| PubChem CID | 143479002 |
| Molecular Formula | C32H46ClN3O4S |
| Molecular Weight | 604.26 g/mol |
| Exact Mass | 603.29 |
| IUPAC Name | (3R)-4-[4-(2-chlorophenyl)piperazin-1-yl]-2,3-dihydroxy-N-[2-[4-[(4Z)-3-methylnona-4,8-dienyl]thiophen-2-yl]ethyl]-4-oxobutanamide;ethane |
| SMILES | C=CCC/C=C\C(C)CCc1csc(CCNC(=O)C(O)[C@@H](O)C(=O)N2CCN(c3ccccc3Cl)CC2)c1.CC |
| InChI | InChI=1S/C30H40ClN3O4S.C2H6/c1-3-4-5-6-9-22(2)12-13-23-20-24(39-21-23)14-15-32-29(37)27(35)28(36)30(38)34-18-16-33(17-19-34)26-11-8-7-10-25(26)31;1-2/h3,6-11,20-22,27-28,35-36H,1,4-5,12-19H2,2H3,(H,32,37);1-2H3/b9-6-;/t22?,27?,28-;/m1./s1 |
| InChIKey | YAJUUNRHKYXZNS-GFLXMJKBSA-N |
| XLogP | 5.25 |
| TPSA | 93.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.26 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|