C19H28ClNO5 — CID 143479334
[2-(3-chlorophenyl)pyrrolidin-1-yl]-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methanone;ethane;formic acid (PubChem CID 143479334) has the molecular formula C19H28ClNO5 and a molecular weight of 385.89 g/mol. Its IUPAC name is [2-(3-chlorophenyl)pyrrolidin-1-yl]-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methanone;ethane;formic acid.
| Compound Name | [2-(3-chlorophenyl)pyrrolidin-1-yl]-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methanone;ethane;formic acid |
|---|---|
| PubChem CID | 143479334 |
| Molecular Formula | C19H28ClNO5 |
| Molecular Weight | 385.89 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | [2-(3-chlorophenyl)pyrrolidin-1-yl]-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methanone;ethane;formic acid |
| SMILES | CC.CC1(C)OC[C@H](C(=O)N2CCCC2c2cccc(Cl)c2)O1.O=CO |
| InChI | InChI=1S/C16H20ClNO3.C2H6.CH2O2/c1-16(2)20-10-14(21-16)15(19)18-8-4-7-13(18)11-5-3-6-12(17)9-11;1-2;2-1-3/h3,5-6,9,13-14H,4,7-8,10H2,1-2H3;1-2H3;1H,(H,2,3)/t13?,14-;;/m1../s1 |
| InChIKey | HPHASGCFSHRDSG-RNPIIYMOSA-N |
| XLogP | 3.88 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.89 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|