C15H16FN3O5 — CID 143480080
ethyl (E)-3-[[(E)-3-amino-1-(3-fluoro-4-nitrophenyl)-3-oxoprop-1-en-2-yl]amino]-2-methylprop-2-enoate (PubChem CID 143480080) has the molecular formula C15H16FN3O5 and a molecular weight of 337.31 g/mol. Its IUPAC name is ethyl (E)-3-[[(E)-3-amino-1-(3-fluoro-4-nitrophenyl)-3-oxoprop-1-en-2-yl]amino]-2-methylprop-2-enoate.
| Compound Name | ethyl (E)-3-[[(E)-3-amino-1-(3-fluoro-4-nitrophenyl)-3-oxoprop-1-en-2-yl]amino]-2-methylprop-2-enoate |
|---|---|
| PubChem CID | 143480080 |
| Molecular Formula | C15H16FN3O5 |
| Molecular Weight | 337.31 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | ethyl (E)-3-[[(E)-3-amino-1-(3-fluoro-4-nitrophenyl)-3-oxoprop-1-en-2-yl]amino]-2-methylprop-2-enoate |
| SMILES | CCOC(=O)/C(C)=C/N/C(=C/c1ccc([N+](=O)[O-])c(F)c1)C(N)=O |
| InChI | InChI=1S/C15H16FN3O5/c1-3-24-15(21)9(2)8-18-12(14(17)20)7-10-4-5-13(19(22)23)11(16)6-10/h4-8,18H,3H2,1-2H3,(H2,17,20)/b9-8+,12-7+ |
| InChIKey | OLGRIXCJCMZWBG-RUQWLHCNSA-N |
| XLogP | 1.62 |
| TPSA | 124.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.31 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|