C9H16O2S — CID 143482244
3,3-dimethyl-1,4-dioxa-8-thiaspiro[4.5]decane (PubChem CID 143482244) has the molecular formula C9H16O2S and a molecular weight of 188.29 g/mol. Its IUPAC name is 3,3-dimethyl-1,4-dioxa-8-thiaspiro[4.5]decane.
| Compound Name | 3,3-dimethyl-1,4-dioxa-8-thiaspiro[4.5]decane |
|---|---|
| PubChem CID | 143482244 |
| Molecular Formula | C9H16O2S |
| Molecular Weight | 188.29 g/mol |
| Exact Mass | 188.09 |
| IUPAC Name | 3,3-dimethyl-1,4-dioxa-8-thiaspiro[4.5]decane |
| SMILES | CC1(C)COC2(CCSCC2)O1 |
| InChI | InChI=1S/C9H16O2S/c1-8(2)7-10-9(11-8)3-5-12-6-4-9/h3-7H2,1-2H3 |
| InChIKey | ZUKQCEGQHMPNRU-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.29 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |