C8H14O2S — CID 135016905
(6S)-6-methyl-1,4-dioxa-8-thiaspiro[4.5]decane (PubChem CID 135016905) has the molecular formula C8H14O2S and a molecular weight of 174.26 g/mol. Its IUPAC name is (6S)-6-methyl-1,4-dioxa-8-thiaspiro[4.5]decane.
| Compound Name | (6S)-6-methyl-1,4-dioxa-8-thiaspiro[4.5]decane |
|---|---|
| PubChem CID | 135016905 |
| Molecular Formula | C8H14O2S |
| Molecular Weight | 174.26 g/mol |
| Exact Mass | 174.07 |
| IUPAC Name | (6S)-6-methyl-1,4-dioxa-8-thiaspiro[4.5]decane |
| SMILES | C[C@@H]1CSCCC12OCCO2 |
| InChI | InChI=1S/C8H14O2S/c1-7-6-11-5-2-8(7)9-3-4-10-8/h7H,2-6H2,1H3/t7-/m1/s1 |
| InChIKey | BFPWBWCLLHKMMA-SSDOTTSWSA-N |
| XLogP | 1.50 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.26 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |