C19H35NO2 — CID 143482708
cyclohexanol;ethane;2-(4-methoxyphenyl)-N,N-dimethylethanamine (PubChem CID 143482708) has the molecular formula C19H35NO2 and a molecular weight of 309.49 g/mol. Its IUPAC name is cyclohexanol;ethane;2-(4-methoxyphenyl)-N,N-dimethylethanamine.
| Compound Name | cyclohexanol;ethane;2-(4-methoxyphenyl)-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 143482708 |
| Molecular Formula | C19H35NO2 |
| Molecular Weight | 309.49 g/mol |
| Exact Mass | 309.27 |
| IUPAC Name | cyclohexanol;ethane;2-(4-methoxyphenyl)-N,N-dimethylethanamine |
| SMILES | CC.COc1ccc(CCN(C)C)cc1.OC1CCCCC1 |
| InChI | InChI=1S/C11H17NO.C6H12O.C2H6/c1-12(2)9-8-10-4-6-11(13-3)7-5-10;7-6-4-2-1-3-5-6;1-2/h4-7H,8-9H2,1-3H3;6-7H,1-5H2;1-2H3 |
| InChIKey | XDKREZVCOWIECI-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.49 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |