C28H29F3N8O — CID 143483716
acetylene;(Z)-but-2-ene;(E)-4-imidazol-1-yl-2-methyl-N-[6-[3-(pyridin-3-ylmethyl)-5-(trifluoromethyl)pyrazol-1-yl]pyridazin-3-yl]but-2-enamide (PubChem CID 143483716) has the molecular formula C28H29F3N8O and a molecular weight of 550.59 g/mol. Its IUPAC name is acetylene;(Z)-but-2-ene;(E)-4-imidazol-1-yl-2-methyl-N-[6-[3-(pyridin-3-ylmethyl)-5-(trifluoromethyl)pyrazol-1-yl]pyridazin-3-yl]but-2-enamide.
| Compound Name | acetylene;(Z)-but-2-ene;(E)-4-imidazol-1-yl-2-methyl-N-[6-[3-(pyridin-3-ylmethyl)-5-(trifluoromethyl)pyrazol-1-yl]pyridazin-3-yl]but-2-enamide |
|---|---|
| PubChem CID | 143483716 |
| Molecular Formula | C28H29F3N8O |
| Molecular Weight | 550.59 g/mol |
| Exact Mass | 550.24 |
| IUPAC Name | acetylene;(Z)-but-2-ene;(E)-4-imidazol-1-yl-2-methyl-N-[6-[3-(pyridin-3-ylmethyl)-5-(trifluoromethyl)pyrazol-1-yl]pyridazin-3-yl]but-2-enamide |
| SMILES | C#C.C/C(=C\Cn1ccnc1)C(=O)Nc1ccc(-n2nc(Cc3cccnc3)cc2C(F)(F)F)nn1.C/C=C\C |
| InChI | InChI=1S/C22H19F3N8O.C4H8.C2H2/c1-15(6-9-32-10-8-27-14-32)21(34)28-19-4-5-20(30-29-19)33-18(22(23,24)25)12-17(31-33)11-16-3-2-7-26-13-16;1-3-4-2;1-2/h2-8,10,12-14H,9,11H2,1H3,(H,28,29,34);3-4H,1-2H3;1-2H/b15-6+;4-3-; |
| InChIKey | FUDXGOVDRQOPFB-HNTFJSQISA-N |
| XLogP | 5.28 |
| TPSA | 103.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.59 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|