C18H14F3N7O2 — CID 89354169
(2Z)-2-aminooxy-N-[6-[3-pyridin-3-yl-5-(trifluoromethyl)pyrazol-1-yl]pyridazin-3-yl]penta-2,4-dienamide (PubChem CID 89354169) has the molecular formula C18H14F3N7O2 and a molecular weight of 417.35 g/mol. Its IUPAC name is (2Z)-2-aminooxy-N-[6-[3-pyridin-3-yl-5-(trifluoromethyl)pyrazol-1-yl]pyridazin-3-yl]penta-2,4-dienamide.
| Compound Name | (2Z)-2-aminooxy-N-[6-[3-pyridin-3-yl-5-(trifluoromethyl)pyrazol-1-yl]pyridazin-3-yl]penta-2,4-dienamide |
|---|---|
| PubChem CID | 89354169 |
| Molecular Formula | C18H14F3N7O2 |
| Molecular Weight | 417.35 g/mol |
| Exact Mass | 417.12 |
| IUPAC Name | (2Z)-2-aminooxy-N-[6-[3-pyridin-3-yl-5-(trifluoromethyl)pyrazol-1-yl]pyridazin-3-yl]penta-2,4-dienamide |
| SMILES | C=C/C=C(\ON)C(=O)Nc1ccc(-n2nc(-c3cccnc3)cc2C(F)(F)F)nn1 |
| InChI | InChI=1S/C18H14F3N7O2/c1-2-4-13(30-22)17(29)24-15-6-7-16(26-25-15)28-14(18(19,20)21)9-12(27-28)11-5-3-8-23-10-11/h2-10H,1,22H2,(H,24,25,29)/b13-4- |
| InChIKey | GYXNRXJDFJMLQD-PQMHYQBVSA-N |
| XLogP | 2.64 |
| TPSA | 120.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.35 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|