C22H18F3N5O — CID 89354150
N-[(1Z,3E)-1-aminohexa-1,3,5-trien-3-yl]-4-[3-pyridin-3-yl-5-(trifluoromethyl)pyrazol-1-yl]benzamide (PubChem CID 89354150) has the molecular formula C22H18F3N5O and a molecular weight of 425.41 g/mol. Its IUPAC name is N-[(1Z,3E)-1-aminohexa-1,3,5-trien-3-yl]-4-[3-pyridin-3-yl-5-(trifluoromethyl)pyrazol-1-yl]benzamide.
| Compound Name | N-[(1Z,3E)-1-aminohexa-1,3,5-trien-3-yl]-4-[3-pyridin-3-yl-5-(trifluoromethyl)pyrazol-1-yl]benzamide |
|---|---|
| PubChem CID | 89354150 |
| Molecular Formula | C22H18F3N5O |
| Molecular Weight | 425.41 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | N-[(1Z,3E)-1-aminohexa-1,3,5-trien-3-yl]-4-[3-pyridin-3-yl-5-(trifluoromethyl)pyrazol-1-yl]benzamide |
| SMILES | C=C/C=C(\C=C/N)NC(=O)c1ccc(-n2nc(-c3cccnc3)cc2C(F)(F)F)cc1 |
| InChI | InChI=1S/C22H18F3N5O/c1-2-4-17(10-11-26)28-21(31)15-6-8-18(9-7-15)30-20(22(23,24)25)13-19(29-30)16-5-3-12-27-14-16/h2-14H,1,26H2,(H,28,31)/b11-10-,17-4+ |
| InChIKey | MRMGIDOHBPSASM-SQZGBDBDSA-N |
| XLogP | 4.23 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.41 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|