C18H14F6N6 — CID 155443623
(Z)-2-[amino(pyridin-3-yl)amino]-1-[4-[3,5-bis(trifluoromethyl)pyrazol-1-yl]phenyl]ethenamine (PubChem CID 155443623) has the molecular formula C18H14F6N6 and a molecular weight of 428.34 g/mol. Its IUPAC name is (Z)-2-[amino(pyridin-3-yl)amino]-1-[4-[3,5-bis(trifluoromethyl)pyrazol-1-yl]phenyl]ethenamine.
| Compound Name | (Z)-2-[amino(pyridin-3-yl)amino]-1-[4-[3,5-bis(trifluoromethyl)pyrazol-1-yl]phenyl]ethenamine |
|---|---|
| PubChem CID | 155443623 |
| Molecular Formula | C18H14F6N6 |
| Molecular Weight | 428.34 g/mol |
| Exact Mass | 428.12 |
| IUPAC Name | (Z)-2-[amino(pyridin-3-yl)amino]-1-[4-[3,5-bis(trifluoromethyl)pyrazol-1-yl]phenyl]ethenamine |
| SMILES | N/C(=C\N(N)c1cccnc1)c1ccc(-n2nc(C(F)(F)F)cc2C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H14F6N6/c19-17(20,21)15-8-16(18(22,23)24)30(28-15)12-5-3-11(4-6-12)14(25)10-29(26)13-2-1-7-27-9-13/h1-10H,25-26H2/b14-10- |
| InChIKey | FRKRHFZEJQFOQO-UVTDQMKNSA-N |
| XLogP | 3.94 |
| TPSA | 85.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.34 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|