C17H15F6N3O2 — CID 162589589
(E)-1-[3-[3,5-bis(trifluoromethyl)pyrazol-1-yl]-N-methylanilino]-2-hydroxypent-1-en-3-one (PubChem CID 162589589) has the molecular formula C17H15F6N3O2 and a molecular weight of 407.31 g/mol. Its IUPAC name is (E)-1-[3-[3,5-bis(trifluoromethyl)pyrazol-1-yl]-N-methylanilino]-2-hydroxypent-1-en-3-one.
| Compound Name | (E)-1-[3-[3,5-bis(trifluoromethyl)pyrazol-1-yl]-N-methylanilino]-2-hydroxypent-1-en-3-one |
|---|---|
| PubChem CID | 162589589 |
| Molecular Formula | C17H15F6N3O2 |
| Molecular Weight | 407.31 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | (E)-1-[3-[3,5-bis(trifluoromethyl)pyrazol-1-yl]-N-methylanilino]-2-hydroxypent-1-en-3-one |
| SMILES | CCC(=O)/C(O)=C\N(C)c1cccc(-n2nc(C(F)(F)F)cc2C(F)(F)F)c1 |
| InChI | InChI=1S/C17H15F6N3O2/c1-3-12(27)13(28)9-25(2)10-5-4-6-11(7-10)26-15(17(21,22)23)8-14(24-26)16(18,19)20/h4-9,28H,3H2,1-2H3/b13-9+ |
| InChIKey | GKEKDIBBSAUIDT-UKTHLTGXSA-N |
| XLogP | 4.72 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.31 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|