C19H13F6N3O3S — CID 10184105
N-[4-[3,5-bis(trifluoromethyl)pyrazol-1-yl]phenyl]-3-methylsulfonylbenzamide (PubChem CID 10184105) has the molecular formula C19H13F6N3O3S and a molecular weight of 477.39 g/mol. Its IUPAC name is N-[4-[3,5-bis(trifluoromethyl)pyrazol-1-yl]phenyl]-3-methylsulfonylbenzamide.
| Compound Name | N-[4-[3,5-bis(trifluoromethyl)pyrazol-1-yl]phenyl]-3-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 10184105 |
| Molecular Formula | C19H13F6N3O3S |
| Molecular Weight | 477.39 g/mol |
| Exact Mass | 477.06 |
| IUPAC Name | N-[4-[3,5-bis(trifluoromethyl)pyrazol-1-yl]phenyl]-3-methylsulfonylbenzamide |
| SMILES | CS(=O)(=O)c1cccc(C(=O)Nc2ccc(-n3nc(C(F)(F)F)cc3C(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C19H13F6N3O3S/c1-32(30,31)14-4-2-3-11(9-14)17(29)26-12-5-7-13(8-6-12)28-16(19(23,24)25)10-15(27-28)18(20,21)22/h2-10H,1H3,(H,26,29) |
| InChIKey | VDOUKRLXABJYIO-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.39 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |