C18H8F9N3O — CID 54472602
N-[4-[3,5-bis(trifluoromethyl)pyrazol-1-yl]phenyl]-3,4,5-trifluorobenzamide (PubChem CID 54472602) has the molecular formula C18H8F9N3O and a molecular weight of 453.26 g/mol. Its IUPAC name is N-[4-[3,5-bis(trifluoromethyl)pyrazol-1-yl]phenyl]-3,4,5-trifluorobenzamide.
| Compound Name | N-[4-[3,5-bis(trifluoromethyl)pyrazol-1-yl]phenyl]-3,4,5-trifluorobenzamide |
|---|---|
| PubChem CID | 54472602 |
| Molecular Formula | C18H8F9N3O |
| Molecular Weight | 453.26 g/mol |
| Exact Mass | 453.05 |
| IUPAC Name | N-[4-[3,5-bis(trifluoromethyl)pyrazol-1-yl]phenyl]-3,4,5-trifluorobenzamide |
| SMILES | O=C(Nc1ccc(-n2nc(C(F)(F)F)cc2C(F)(F)F)cc1)c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C18H8F9N3O/c19-11-5-8(6-12(20)15(11)21)16(31)28-9-1-3-10(4-2-9)30-14(18(25,26)27)7-13(29-30)17(22,23)24/h1-7H,(H,28,31) |
| InChIKey | XJJKTGYOULEJLR-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.26 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|