C20H8F9N3 — CID 87541192
3-[4-[3,5-bis(trifluoromethyl)pyrazol-1-yl]phenyl]-2-(3,4,5-trifluorophenyl)prop-2-enenitrile (PubChem CID 87541192) has the molecular formula C20H8F9N3 and a molecular weight of 461.29 g/mol. Its IUPAC name is 3-[4-[3,5-bis(trifluoromethyl)pyrazol-1-yl]phenyl]-2-(3,4,5-trifluorophenyl)prop-2-enenitrile.
| Compound Name | 3-[4-[3,5-bis(trifluoromethyl)pyrazol-1-yl]phenyl]-2-(3,4,5-trifluorophenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 87541192 |
| Molecular Formula | C20H8F9N3 |
| Molecular Weight | 461.29 g/mol |
| Exact Mass | 461.06 |
| IUPAC Name | 3-[4-[3,5-bis(trifluoromethyl)pyrazol-1-yl]phenyl]-2-(3,4,5-trifluorophenyl)prop-2-enenitrile |
| SMILES | N#CC(=Cc1ccc(-n2nc(C(F)(F)F)cc2C(F)(F)F)cc1)c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C20H8F9N3/c21-14-6-11(7-15(22)18(14)23)12(9-30)5-10-1-3-13(4-2-10)32-17(20(27,28)29)8-16(31-32)19(24,25)26/h1-8H |
| InChIKey | NSOYFNSZTGAPTO-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 41.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.29 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|