C20H9F8N3 — CID 89318509
(Z)-3-[4-[3,5-bis(trifluoromethyl)pyrazol-1-yl]phenyl]-2-(2,5-difluorophenyl)prop-2-enenitrile (PubChem CID 89318509) has the molecular formula C20H9F8N3 and a molecular weight of 443.30 g/mol. Its IUPAC name is (Z)-3-[4-[3,5-bis(trifluoromethyl)pyrazol-1-yl]phenyl]-2-(2,5-difluorophenyl)prop-2-enenitrile.
| Compound Name | (Z)-3-[4-[3,5-bis(trifluoromethyl)pyrazol-1-yl]phenyl]-2-(2,5-difluorophenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 89318509 |
| Molecular Formula | C20H9F8N3 |
| Molecular Weight | 443.30 g/mol |
| Exact Mass | 443.07 |
| IUPAC Name | (Z)-3-[4-[3,5-bis(trifluoromethyl)pyrazol-1-yl]phenyl]-2-(2,5-difluorophenyl)prop-2-enenitrile |
| SMILES | N#C/C(=C\c1ccc(-n2nc(C(F)(F)F)cc2C(F)(F)F)cc1)c1cc(F)ccc1F |
| InChI | InChI=1S/C20H9F8N3/c21-13-3-6-16(22)15(8-13)12(10-29)7-11-1-4-14(5-2-11)31-18(20(26,27)28)9-17(30-31)19(23,24)25/h1-9H/b12-7+ |
| InChIKey | OXWLORVWMXLOMI-KPKJPENVSA-N |
| XLogP | 6.25 |
| TPSA | 41.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.30 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|