C21H9F8N3O — CID 59264882
(E)-3-[4-[3,5-bis(trifluoromethyl)pyrazol-1-yl]phenyl]-2-(2,3-difluorobenzoyl)prop-2-enenitrile (PubChem CID 59264882) has the molecular formula C21H9F8N3O and a molecular weight of 471.31 g/mol. Its IUPAC name is (E)-3-[4-[3,5-bis(trifluoromethyl)pyrazol-1-yl]phenyl]-2-(2,3-difluorobenzoyl)prop-2-enenitrile.
| Compound Name | (E)-3-[4-[3,5-bis(trifluoromethyl)pyrazol-1-yl]phenyl]-2-(2,3-difluorobenzoyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 59264882 |
| Molecular Formula | C21H9F8N3O |
| Molecular Weight | 471.31 g/mol |
| Exact Mass | 471.06 |
| IUPAC Name | (E)-3-[4-[3,5-bis(trifluoromethyl)pyrazol-1-yl]phenyl]-2-(2,3-difluorobenzoyl)prop-2-enenitrile |
| SMILES | N#C/C(=C\c1ccc(-n2nc(C(F)(F)F)cc2C(F)(F)F)cc1)C(=O)c1cccc(F)c1F |
| InChI | InChI=1S/C21H9F8N3O/c22-15-3-1-2-14(18(15)23)19(33)12(10-30)8-11-4-6-13(7-5-11)32-17(21(27,28)29)9-16(31-32)20(24,25)26/h1-9H/b12-8+ |
| InChIKey | HZBUSUOSDVDACX-XYOKQWHBSA-N |
| XLogP | 5.98 |
| TPSA | 58.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.31 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|