C20H11F6N3 — CID 57436883
3-[(Z)-2-[4-[3,5-bis(trifluoromethyl)pyrazol-1-yl]phenyl]ethenyl]benzonitrile (PubChem CID 57436883) has the molecular formula C20H11F6N3 and a molecular weight of 407.32 g/mol. Its IUPAC name is 3-[(Z)-2-[4-[3,5-bis(trifluoromethyl)pyrazol-1-yl]phenyl]ethenyl]benzonitrile.
| Compound Name | 3-[(Z)-2-[4-[3,5-bis(trifluoromethyl)pyrazol-1-yl]phenyl]ethenyl]benzonitrile |
|---|---|
| PubChem CID | 57436883 |
| Molecular Formula | C20H11F6N3 |
| Molecular Weight | 407.32 g/mol |
| Exact Mass | 407.09 |
| IUPAC Name | 3-[(Z)-2-[4-[3,5-bis(trifluoromethyl)pyrazol-1-yl]phenyl]ethenyl]benzonitrile |
| SMILES | N#Cc1cccc(/C=C\c2ccc(-n3nc(C(F)(F)F)cc3C(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C20H11F6N3/c21-19(22,23)17-11-18(20(24,25)26)29(28-17)16-8-6-13(7-9-16)4-5-14-2-1-3-15(10-14)12-27/h1-11H/b5-4- |
| InChIKey | SEDSLHYZOVGYPI-PLNGDYQASA-N |
| XLogP | 5.95 |
| TPSA | 41.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.32 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|