About 3-[(Z)-2-[4-[3,5-bis(trifluoromethyl)pyrazol-1-yl]phenyl]ethenyl]benzonitrile
3-[(Z)-2-[4-[3,5-bis(trifluoromethyl)pyrazol-1-yl]phenyl]ethenyl]benzonitrile (PubChem CID 57436883) has the molecular formula C20H11F6N3
and a molecular weight of 407.32 g/mol. Its IUPAC name is 3-[(Z)-2-[4-[3,5-bis(trifluoromethyl)pyrazol-1-yl]phenyl]ethenyl]benzonitrile.
Molecular Properties
| Compound Name | 3-[(Z)-2-[4-[3,5-bis(trifluoromethyl)pyrazol-1-yl]phenyl]ethenyl]benzonitrile |
| PubChem CID | 57436883 |
| Molecular Formula | C20H11F6N3 |
| Molecular Weight | 407.32 g/mol |
| Exact Mass | 407.09 |
| IUPAC Name | 3-[(Z)-2-[4-[3,5-bis(trifluoromethyl)pyrazol-1-yl]phenyl]ethenyl]benzonitrile |
| SMILES | N#Cc1cccc(/C=C\c2ccc(-n3nc(C(F)(F)F)cc3C(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C20H11F6N3/c21-19(22,23)17-11-18(20(24,25)26)29(28-17)16-8-6-13(7-9-16)4-5-14-2-1-3-15(10-14)12-27/h1-11H/b5-4- |
| InChIKey | SEDSLHYZOVGYPI-PLNGDYQASA-N |
| XLogP | 5.95 |
| TPSA | 41.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 407.32 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 3-[(Z)-2-[4-[3,5-bis(trifluoromethyl)pyrazol-1-yl]phenyl]ethenyl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(Z)-2-[4-[3,5-bis(trifluoromethyl)pyrazol-1-yl]phenyl]ethenyl]benzonitrile?
The IUPAC name of 3-[(Z)-2-[4-[3,5-bis(trifluoromethyl)pyrazol-1-yl]phenyl]ethenyl]benzonitrile (CID 57436883) is 3-[(Z)-2-[4-[3,5-bis(trifluoromethyl)pyrazol-1-yl]phenyl]ethenyl]benzonitrile.
What is the SMILES notation for 3-[(Z)-2-[4-[3,5-bis(trifluoromethyl)pyrazol-1-yl]phenyl]ethenyl]benzonitrile?
The canonical SMILES for 3-[(Z)-2-[4-[3,5-bis(trifluoromethyl)pyrazol-1-yl]phenyl]ethenyl]benzonitrile is N#Cc1cccc(/C=C\c2ccc(-n3nc(C(F)(F)F)cc3C(F)(F)F)cc2)c1.
What is the InChIKey of 3-[(Z)-2-[4-[3,5-bis(trifluoromethyl)pyrazol-1-yl]phenyl]ethenyl]benzonitrile?
The InChIKey is SEDSLHYZOVGYPI-PLNGDYQASA-N. The full InChI is InChI=1S/C20H11F6N3/c21-19(22,23)17-11-18(20(24,25)26)29(28-17)16-8-6-13(7-9-16)4-5-14-2-1-3-15(10-14)12-27/h1-11H/b5-4-.
What are the key properties of 3-[(Z)-2-[4-[3,5-bis(trifluoromethyl)pyrazol-1-yl]phenyl]ethenyl]benzonitrile?
3-[(Z)-2-[4-[3,5-bis(trifluoromethyl)pyrazol-1-yl]phenyl]ethenyl]benzonitrile has a molecular weight of 407.32 g/mol, XLogP of 5.95, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(Z)-2-[4-[3,5-bis(trifluoromethyl)pyrazol-1-yl]phenyl]ethenyl]benzonitrile is sourced from PubChem (CID 57436883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).