C12H8F3N3O2 — CID 126688167
3-[5-(dihydroxymethyl)-3-(trifluoromethyl)pyrazol-1-yl]benzonitrile (PubChem CID 126688167) has the molecular formula C12H8F3N3O2 and a molecular weight of 283.21 g/mol. Its IUPAC name is 3-[5-(dihydroxymethyl)-3-(trifluoromethyl)pyrazol-1-yl]benzonitrile.
| Compound Name | 3-[5-(dihydroxymethyl)-3-(trifluoromethyl)pyrazol-1-yl]benzonitrile |
|---|---|
| PubChem CID | 126688167 |
| Molecular Formula | C12H8F3N3O2 |
| Molecular Weight | 283.21 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | 3-[5-(dihydroxymethyl)-3-(trifluoromethyl)pyrazol-1-yl]benzonitrile |
| SMILES | N#Cc1cccc(-n2nc(C(F)(F)F)cc2C(O)O)c1 |
| InChI | InChI=1S/C12H8F3N3O2/c13-12(14,15)10-5-9(11(19)20)18(17-10)8-3-1-2-7(4-8)6-16/h1-5,11,19-20H |
| InChIKey | MWNOCLLSVPUAPV-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 82.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.21 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|