C11H5F3N4O2 — CID 174629459
1-(3-cyanophenyl)-5-(trifluoromethyl)triazole-4-carboxylic acid (PubChem CID 174629459) has the molecular formula C11H5F3N4O2 and a molecular weight of 282.18 g/mol. Its IUPAC name is 1-(3-cyanophenyl)-5-(trifluoromethyl)triazole-4-carboxylic acid.
| Compound Name | 1-(3-cyanophenyl)-5-(trifluoromethyl)triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 174629459 |
| Molecular Formula | C11H5F3N4O2 |
| Molecular Weight | 282.18 g/mol |
| Exact Mass | 282.04 |
| IUPAC Name | 1-(3-cyanophenyl)-5-(trifluoromethyl)triazole-4-carboxylic acid |
| SMILES | N#Cc1cccc(-n2nnc(C(=O)O)c2C(F)(F)F)c1 |
| InChI | InChI=1S/C11H5F3N4O2/c12-11(13,14)9-8(10(19)20)16-17-18(9)7-3-1-2-6(4-7)5-15/h1-4H,(H,19,20) |
| InChIKey | NXAJCBKDJZXTFP-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 91.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.18 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |