About (Z)-1-(4-aminophenyl)-N'-[4-[3,5-bis(trifluoromethyl)pyrazol-1-yl]phenyl]ethene-1,2-diamine
(Z)-1-(4-aminophenyl)-N'-[4-[3,5-bis(trifluoromethyl)pyrazol-1-yl]phenyl]ethene-1,2-diamine (PubChem CID 145414734) has the molecular formula C19H15F6N5
and a molecular weight of 427.35 g/mol. Its IUPAC name is (Z)-1-(4-aminophenyl)-N'-[4-[3,5-bis(trifluoromethyl)pyrazol-1-yl]phenyl]ethene-1,2-diamine.
Molecular Properties
| Compound Name | (Z)-1-(4-aminophenyl)-N'-[4-[3,5-bis(trifluoromethyl)pyrazol-1-yl]phenyl]ethene-1,2-diamine |
| PubChem CID | 145414734 |
| Molecular Formula | C19H15F6N5 |
| Molecular Weight | 427.35 g/mol |
| Exact Mass | 427.12 |
| IUPAC Name | (Z)-1-(4-aminophenyl)-N'-[4-[3,5-bis(trifluoromethyl)pyrazol-1-yl]phenyl]ethene-1,2-diamine |
| SMILES | N/C(=C\Nc1ccc(-n2nc(C(F)(F)F)cc2C(F)(F)F)cc1)c1ccc(N)cc1 |
| InChI | InChI=1S/C19H15F6N5/c20-18(21,22)16-9-17(19(23,24)25)30(29-16)14-7-5-13(6-8-14)28-10-15(27)11-1-3-12(26)4-2-11/h1-10,28H,26-27H2/b15-10- |
| InChIKey | FRWFDAWPOZSLBC-GDNBJRDFSA-N |
| XLogP | 4.86 |
| TPSA | 81.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 427.35 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze (Z)-1-(4-aminophenyl)-N'-[4-[3,5-bis(trifluoromethyl)pyrazol-1-yl]phenyl]ethene-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-1-(4-aminophenyl)-N'-[4-[3,5-bis(trifluoromethyl)pyrazol-1-yl]phenyl]ethene-1,2-diamine?
The IUPAC name of (Z)-1-(4-aminophenyl)-N'-[4-[3,5-bis(trifluoromethyl)pyrazol-1-yl]phenyl]ethene-1,2-diamine (CID 145414734) is (Z)-1-(4-aminophenyl)-N'-[4-[3,5-bis(trifluoromethyl)pyrazol-1-yl]phenyl]ethene-1,2-diamine.
What is the SMILES notation for (Z)-1-(4-aminophenyl)-N'-[4-[3,5-bis(trifluoromethyl)pyrazol-1-yl]phenyl]ethene-1,2-diamine?
The canonical SMILES for (Z)-1-(4-aminophenyl)-N'-[4-[3,5-bis(trifluoromethyl)pyrazol-1-yl]phenyl]ethene-1,2-diamine is N/C(=C\Nc1ccc(-n2nc(C(F)(F)F)cc2C(F)(F)F)cc1)c1ccc(N)cc1.
What is the InChIKey of (Z)-1-(4-aminophenyl)-N'-[4-[3,5-bis(trifluoromethyl)pyrazol-1-yl]phenyl]ethene-1,2-diamine?
The InChIKey is FRWFDAWPOZSLBC-GDNBJRDFSA-N. The full InChI is InChI=1S/C19H15F6N5/c20-18(21,22)16-9-17(19(23,24)25)30(29-16)14-7-5-13(6-8-14)28-10-15(27)11-1-3-12(26)4-2-11/h1-10,28H,26-27H2/b15-10-.
What are the key properties of (Z)-1-(4-aminophenyl)-N'-[4-[3,5-bis(trifluoromethyl)pyrazol-1-yl]phenyl]ethene-1,2-diamine?
(Z)-1-(4-aminophenyl)-N'-[4-[3,5-bis(trifluoromethyl)pyrazol-1-yl]phenyl]ethene-1,2-diamine has a molecular weight of 427.35 g/mol, XLogP of 4.86, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-1-(4-aminophenyl)-N'-[4-[3,5-bis(trifluoromethyl)pyrazol-1-yl]phenyl]ethene-1,2-diamine is sourced from PubChem (CID 145414734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).