C15H13F6N5OS — CID 144973362
(Z)-3-amino-2-aminosulfanyl-N-[4-[3,5-bis(trifluoromethyl)pyrazol-1-yl]phenyl]but-2-enamide (PubChem CID 144973362) has the molecular formula C15H13F6N5OS and a molecular weight of 425.36 g/mol. Its IUPAC name is (Z)-3-amino-2-aminosulfanyl-N-[4-[3,5-bis(trifluoromethyl)pyrazol-1-yl]phenyl]but-2-enamide.
| Compound Name | (Z)-3-amino-2-aminosulfanyl-N-[4-[3,5-bis(trifluoromethyl)pyrazol-1-yl]phenyl]but-2-enamide |
|---|---|
| PubChem CID | 144973362 |
| Molecular Formula | C15H13F6N5OS |
| Molecular Weight | 425.36 g/mol |
| Exact Mass | 425.07 |
| IUPAC Name | (Z)-3-amino-2-aminosulfanyl-N-[4-[3,5-bis(trifluoromethyl)pyrazol-1-yl]phenyl]but-2-enamide |
| SMILES | C/C(N)=C(/SN)C(=O)Nc1ccc(-n2nc(C(F)(F)F)cc2C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H13F6N5OS/c1-7(22)12(28-23)13(27)24-8-2-4-9(5-3-8)26-11(15(19,20)21)6-10(25-26)14(16,17)18/h2-6H,22-23H2,1H3,(H,24,27)/b12-7- |
| InChIKey | YMKHGSKPBMSFHD-GHXNOFRVSA-N |
| XLogP | 3.65 |
| TPSA | 98.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.36 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|