C18H7Cl2F6N5O5 — CID 57436880
N-[4-[3,5-bis(trifluoromethyl)pyrazol-1-yl]phenyl]-2,4-dichloro-3,5-dinitrobenzamide (PubChem CID 57436880) has the molecular formula C18H7Cl2F6N5O5 and a molecular weight of 558.18 g/mol. Its IUPAC name is N-[4-[3,5-bis(trifluoromethyl)pyrazol-1-yl]phenyl]-2,4-dichloro-3,5-dinitrobenzamide.
| Compound Name | N-[4-[3,5-bis(trifluoromethyl)pyrazol-1-yl]phenyl]-2,4-dichloro-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 57436880 |
| Molecular Formula | C18H7Cl2F6N5O5 |
| Molecular Weight | 558.18 g/mol |
| Exact Mass | 556.97 |
| IUPAC Name | N-[4-[3,5-bis(trifluoromethyl)pyrazol-1-yl]phenyl]-2,4-dichloro-3,5-dinitrobenzamide |
| SMILES | O=C(Nc1ccc(-n2nc(C(F)(F)F)cc2C(F)(F)F)cc1)c1cc([N+](=O)[O-])c(Cl)c([N+](=O)[O-])c1Cl |
| InChI | InChI=1S/C18H7Cl2F6N5O5/c19-13-9(5-10(30(33)34)14(20)15(13)31(35)36)16(32)27-7-1-3-8(4-2-7)29-12(18(24,25)26)6-11(28-29)17(21,22)23/h1-6H,(H,27,32) |
| InChIKey | OFWFNGGKXHNINI-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 133.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.18 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|