C21H15F3N4O — CID 152770734
[4-[5-naphthalen-2-yl-3-(trifluoromethyl)pyrazol-1-yl]phenyl]urea (PubChem CID 152770734) has the molecular formula C21H15F3N4O and a molecular weight of 396.37 g/mol. Its IUPAC name is [4-[5-naphthalen-2-yl-3-(trifluoromethyl)pyrazol-1-yl]phenyl]urea.
| Compound Name | [4-[5-naphthalen-2-yl-3-(trifluoromethyl)pyrazol-1-yl]phenyl]urea |
|---|---|
| PubChem CID | 152770734 |
| Molecular Formula | C21H15F3N4O |
| Molecular Weight | 396.37 g/mol |
| Exact Mass | 396.12 |
| IUPAC Name | [4-[5-naphthalen-2-yl-3-(trifluoromethyl)pyrazol-1-yl]phenyl]urea |
| SMILES | NC(=O)Nc1ccc(-n2nc(C(F)(F)F)cc2-c2ccc3ccccc3c2)cc1 |
| InChI | InChI=1S/C21H15F3N4O/c22-21(23,24)19-12-18(15-6-5-13-3-1-2-4-14(13)11-15)28(27-19)17-9-7-16(8-10-17)26-20(25)29/h1-12H,(H3,25,26,29) |
| InChIKey | NKJIBMUHGKHEMJ-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.37 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |