About N,N-dimethyl-6-[1-phenyl-5-(trifluoromethyl)pyrazol-3-yl]pyridine-2-carboxamide;ethane
N,N-dimethyl-6-[1-phenyl-5-(trifluoromethyl)pyrazol-3-yl]pyridine-2-carboxamide;ethane (PubChem CID 143534019) has the molecular formula C20H21F3N4O
and a molecular weight of 390.41 g/mol. Its IUPAC name is N,N-dimethyl-6-[1-phenyl-5-(trifluoromethyl)pyrazol-3-yl]pyridine-2-carboxamide;ethane.
Molecular Properties
| Compound Name | N,N-dimethyl-6-[1-phenyl-5-(trifluoromethyl)pyrazol-3-yl]pyridine-2-carboxamide;ethane |
| PubChem CID | 143534019 |
| Molecular Formula | C20H21F3N4O |
| Molecular Weight | 390.41 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | N,N-dimethyl-6-[1-phenyl-5-(trifluoromethyl)pyrazol-3-yl]pyridine-2-carboxamide;ethane |
| SMILES | CC.CN(C)C(=O)c1cccc(-c2cc(C(F)(F)F)n(-c3ccccc3)n2)n1 |
| InChI | InChI=1S/C18H15F3N4O.C2H6/c1-24(2)17(26)14-10-6-9-13(22-14)15-11-16(18(19,20)21)25(23-15)12-7-4-3-5-8-12;1-2/h3-11H,1-2H3;1-2H3 |
| InChIKey | YKSGNVKVYJXFAM-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.41 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N,N-dimethyl-6-[1-phenyl-5-(trifluoromethyl)pyrazol-3-yl]pyridine-2-carboxamide;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethyl-6-[1-phenyl-5-(trifluoromethyl)pyrazol-3-yl]pyridine-2-carboxamide;ethane?
The IUPAC name of N,N-dimethyl-6-[1-phenyl-5-(trifluoromethyl)pyrazol-3-yl]pyridine-2-carboxamide;ethane (CID 143534019) is N,N-dimethyl-6-[1-phenyl-5-(trifluoromethyl)pyrazol-3-yl]pyridine-2-carboxamide;ethane.
What is the SMILES notation for N,N-dimethyl-6-[1-phenyl-5-(trifluoromethyl)pyrazol-3-yl]pyridine-2-carboxamide;ethane?
The canonical SMILES for N,N-dimethyl-6-[1-phenyl-5-(trifluoromethyl)pyrazol-3-yl]pyridine-2-carboxamide;ethane is CC.CN(C)C(=O)c1cccc(-c2cc(C(F)(F)F)n(-c3ccccc3)n2)n1.
What is the InChIKey of N,N-dimethyl-6-[1-phenyl-5-(trifluoromethyl)pyrazol-3-yl]pyridine-2-carboxamide;ethane?
The InChIKey is YKSGNVKVYJXFAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15F3N4O.C2H6/c1-24(2)17(26)14-10-6-9-13(22-14)15-11-16(18(19,20)21)25(23-15)12-7-4-3-5-8-12;1-2/h3-11H,1-2H3;1-2H3.
What are the key properties of N,N-dimethyl-6-[1-phenyl-5-(trifluoromethyl)pyrazol-3-yl]pyridine-2-carboxamide;ethane?
N,N-dimethyl-6-[1-phenyl-5-(trifluoromethyl)pyrazol-3-yl]pyridine-2-carboxamide;ethane has a molecular weight of 390.41 g/mol, XLogP of 4.68, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethyl-6-[1-phenyl-5-(trifluoromethyl)pyrazol-3-yl]pyridine-2-carboxamide;ethane is sourced from PubChem (CID 143534019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).