About 5-[3,5-bis(trifluoromethyl)pyrazol-1-yl]-2-nitrosopyridine
5-[3,5-bis(trifluoromethyl)pyrazol-1-yl]-2-nitrosopyridine (PubChem CID 89285441) has the molecular formula C10H4F6N4O
and a molecular weight of 310.16 g/mol. Its IUPAC name is 5-[3,5-bis(trifluoromethyl)pyrazol-1-yl]-2-nitrosopyridine.
Molecular Properties
| Compound Name | 5-[3,5-bis(trifluoromethyl)pyrazol-1-yl]-2-nitrosopyridine |
| PubChem CID | 89285441 |
| Molecular Formula | C10H4F6N4O |
| Molecular Weight | 310.16 g/mol |
| Exact Mass | 310.03 |
| IUPAC Name | 5-[3,5-bis(trifluoromethyl)pyrazol-1-yl]-2-nitrosopyridine |
| SMILES | O=Nc1ccc(-n2nc(C(F)(F)F)cc2C(F)(F)F)cn1 |
| InChI | InChI=1S/C10H4F6N4O/c11-9(12,13)6-3-7(10(14,15)16)20(18-6)5-1-2-8(19-21)17-4-5/h1-4H |
| InChIKey | WKFIGDZNLALFMF-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 60.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.16 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[3,5-bis(trifluoromethyl)pyrazol-1-yl]-2-nitrosopyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[3,5-bis(trifluoromethyl)pyrazol-1-yl]-2-nitrosopyridine?
The IUPAC name of 5-[3,5-bis(trifluoromethyl)pyrazol-1-yl]-2-nitrosopyridine (CID 89285441) is 5-[3,5-bis(trifluoromethyl)pyrazol-1-yl]-2-nitrosopyridine.
What is the SMILES notation for 5-[3,5-bis(trifluoromethyl)pyrazol-1-yl]-2-nitrosopyridine?
The canonical SMILES for 5-[3,5-bis(trifluoromethyl)pyrazol-1-yl]-2-nitrosopyridine is O=Nc1ccc(-n2nc(C(F)(F)F)cc2C(F)(F)F)cn1.
What is the InChIKey of 5-[3,5-bis(trifluoromethyl)pyrazol-1-yl]-2-nitrosopyridine?
The InChIKey is WKFIGDZNLALFMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H4F6N4O/c11-9(12,13)6-3-7(10(14,15)16)20(18-6)5-1-2-8(19-21)17-4-5/h1-4H.
What are the key properties of 5-[3,5-bis(trifluoromethyl)pyrazol-1-yl]-2-nitrosopyridine?
5-[3,5-bis(trifluoromethyl)pyrazol-1-yl]-2-nitrosopyridine has a molecular weight of 310.16 g/mol, XLogP of 3.70, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[3,5-bis(trifluoromethyl)pyrazol-1-yl]-2-nitrosopyridine is sourced from PubChem (CID 89285441), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).