C10H4F6N4O — CID 89285441
5-[3,5-bis(trifluoromethyl)pyrazol-1-yl]-2-nitrosopyridine (PubChem CID 89285441) has the molecular formula C10H4F6N4O and a molecular weight of 310.16 g/mol. Its IUPAC name is 5-[3,5-bis(trifluoromethyl)pyrazol-1-yl]-2-nitrosopyridine.
| Compound Name | 5-[3,5-bis(trifluoromethyl)pyrazol-1-yl]-2-nitrosopyridine |
|---|---|
| PubChem CID | 89285441 |
| Molecular Formula | C10H4F6N4O |
| Molecular Weight | 310.16 g/mol |
| Exact Mass | 310.03 |
| IUPAC Name | 5-[3,5-bis(trifluoromethyl)pyrazol-1-yl]-2-nitrosopyridine |
| SMILES | O=Nc1ccc(-n2nc(C(F)(F)F)cc2C(F)(F)F)cn1 |
| InChI | InChI=1S/C10H4F6N4O/c11-9(12,13)6-3-7(10(14,15)16)20(18-6)5-1-2-8(19-21)17-4-5/h1-4H |
| InChIKey | WKFIGDZNLALFMF-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 60.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.16 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |