C21H18F3N5O4 — CID 155443688
3-[(Z)-1-amino-2-[N-amino-4-[4-methoxycarbonyl-5-(trifluoromethyl)pyrazol-1-yl]anilino]ethenyl]benzoic acid (PubChem CID 155443688) has the molecular formula C21H18F3N5O4 and a molecular weight of 461.40 g/mol. Its IUPAC name is 3-[(Z)-1-amino-2-[N-amino-4-[4-methoxycarbonyl-5-(trifluoromethyl)pyrazol-1-yl]anilino]ethenyl]benzoic acid.
| Compound Name | 3-[(Z)-1-amino-2-[N-amino-4-[4-methoxycarbonyl-5-(trifluoromethyl)pyrazol-1-yl]anilino]ethenyl]benzoic acid |
|---|---|
| PubChem CID | 155443688 |
| Molecular Formula | C21H18F3N5O4 |
| Molecular Weight | 461.40 g/mol |
| Exact Mass | 461.13 |
| IUPAC Name | 3-[(Z)-1-amino-2-[N-amino-4-[4-methoxycarbonyl-5-(trifluoromethyl)pyrazol-1-yl]anilino]ethenyl]benzoic acid |
| SMILES | COC(=O)c1cnn(-c2ccc(N(N)/C=C(\N)c3cccc(C(=O)O)c3)cc2)c1C(F)(F)F |
| InChI | InChI=1S/C21H18F3N5O4/c1-33-20(32)16-10-27-29(18(16)21(22,23)24)15-7-5-14(6-8-15)28(26)11-17(25)12-3-2-4-13(9-12)19(30)31/h2-11H,25-26H2,1H3,(H,30,31)/b17-11- |
| InChIKey | RXQMDFUGZZYEEQ-BOPFTXTBSA-N |
| XLogP | 3.01 |
| TPSA | 136.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.40 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|