C24H24N6O4 — CID 170187308
4-[amino-[(Z)-2-amino-2-[3-[(Z)-1-amino-2-(N-amino-4-carboxyanilino)ethenyl]phenyl]ethenyl]amino]benzoic acid (PubChem CID 170187308) has the molecular formula C24H24N6O4 and a molecular weight of 460.49 g/mol. Its IUPAC name is 4-[amino-[(Z)-2-amino-2-[3-[(Z)-1-amino-2-(N-amino-4-carboxyanilino)ethenyl]phenyl]ethenyl]amino]benzoic acid.
| Compound Name | 4-[amino-[(Z)-2-amino-2-[3-[(Z)-1-amino-2-(N-amino-4-carboxyanilino)ethenyl]phenyl]ethenyl]amino]benzoic acid |
|---|---|
| PubChem CID | 170187308 |
| Molecular Formula | C24H24N6O4 |
| Molecular Weight | 460.49 g/mol |
| Exact Mass | 460.19 |
| IUPAC Name | 4-[amino-[(Z)-2-amino-2-[3-[(Z)-1-amino-2-(N-amino-4-carboxyanilino)ethenyl]phenyl]ethenyl]amino]benzoic acid |
| SMILES | N/C(=C\N(N)c1ccc(C(=O)O)cc1)c1cccc(/C(N)=C/N(N)c2ccc(C(=O)O)cc2)c1 |
| InChI | InChI=1S/C24H24N6O4/c25-21(13-29(27)19-8-4-15(5-9-19)23(31)32)17-2-1-3-18(12-17)22(26)14-30(28)20-10-6-16(7-11-20)24(33)34/h1-14H,25-28H2,(H,31,32)(H,33,34)/b21-13-,22-14- |
| InChIKey | JQGRKVLEEQZXKH-JZTLMNBPSA-N |
| XLogP | 2.36 |
| TPSA | 185.16 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.49 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|