C24H26N6O3 — CID 170187322
4-[amino-[(Z)-2-amino-2-[3-[(Z)-1-amino-2-(N-amino-4-methoxyanilino)ethenyl]phenyl]ethenyl]amino]benzoic acid (PubChem CID 170187322) has the molecular formula C24H26N6O3 and a molecular weight of 446.51 g/mol. Its IUPAC name is 4-[amino-[(Z)-2-amino-2-[3-[(Z)-1-amino-2-(N-amino-4-methoxyanilino)ethenyl]phenyl]ethenyl]amino]benzoic acid.
| Compound Name | 4-[amino-[(Z)-2-amino-2-[3-[(Z)-1-amino-2-(N-amino-4-methoxyanilino)ethenyl]phenyl]ethenyl]amino]benzoic acid |
|---|---|
| PubChem CID | 170187322 |
| Molecular Formula | C24H26N6O3 |
| Molecular Weight | 446.51 g/mol |
| Exact Mass | 446.21 |
| IUPAC Name | 4-[amino-[(Z)-2-amino-2-[3-[(Z)-1-amino-2-(N-amino-4-methoxyanilino)ethenyl]phenyl]ethenyl]amino]benzoic acid |
| SMILES | COc1ccc(N(N)/C=C(\N)c2cccc(/C(N)=C/N(N)c3ccc(C(=O)O)cc3)c2)cc1 |
| InChI | InChI=1S/C24H26N6O3/c1-33-21-11-9-20(10-12-21)30(28)15-23(26)18-4-2-3-17(13-18)22(25)14-29(27)19-7-5-16(6-8-19)24(31)32/h2-15H,25-28H2,1H3,(H,31,32)/b22-14-,23-15- |
| InChIKey | LVUHWWFHSVYDNN-VMTNTFKOSA-N |
| XLogP | 2.67 |
| TPSA | 157.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.51 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|