C23H23F3N4O5 — CID 3788187
2-(3,5-dimethoxyphenyl)propan-2-yl N-[[1-phenyl-5-(trifluoromethyl)pyrazole-4-carbonyl]amino]carbamate (PubChem CID 3788187) has the molecular formula C23H23F3N4O5 and a molecular weight of 492.45 g/mol. Its IUPAC name is 2-(3,5-dimethoxyphenyl)propan-2-yl N-[[1-phenyl-5-(trifluoromethyl)pyrazole-4-carbonyl]amino]carbamate.
| Compound Name | 2-(3,5-dimethoxyphenyl)propan-2-yl N-[[1-phenyl-5-(trifluoromethyl)pyrazole-4-carbonyl]amino]carbamate |
|---|---|
| PubChem CID | 3788187 |
| Molecular Formula | C23H23F3N4O5 |
| Molecular Weight | 492.45 g/mol |
| Exact Mass | 492.16 |
| IUPAC Name | 2-(3,5-dimethoxyphenyl)propan-2-yl N-[[1-phenyl-5-(trifluoromethyl)pyrazole-4-carbonyl]amino]carbamate |
| SMILES | COc1cc(OC)cc(C(C)(C)OC(=O)NNC(=O)c2cnn(-c3ccccc3)c2C(F)(F)F)c1 |
| InChI | InChI=1S/C23H23F3N4O5/c1-22(2,14-10-16(33-3)12-17(11-14)34-4)35-21(32)29-28-20(31)18-13-27-30(19(18)23(24,25)26)15-8-6-5-7-9-15/h5-13H,1-4H3,(H,28,31)(H,29,32) |
| InChIKey | FNVKYOSPHNFHGF-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 103.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.45 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|