C24H21F3N4O — CID 68976690
N-(2-bicyclo[2.2.1]hept-5-enyl)-N-methyl-4-[3-pyridin-3-yl-5-(trifluoromethyl)pyrazol-1-yl]benzamide (PubChem CID 68976690) has the molecular formula C24H21F3N4O and a molecular weight of 438.45 g/mol. Its IUPAC name is N-(2-bicyclo[2.2.1]hept-5-enyl)-N-methyl-4-[3-pyridin-3-yl-5-(trifluoromethyl)pyrazol-1-yl]benzamide.
| Compound Name | N-(2-bicyclo[2.2.1]hept-5-enyl)-N-methyl-4-[3-pyridin-3-yl-5-(trifluoromethyl)pyrazol-1-yl]benzamide |
|---|---|
| PubChem CID | 68976690 |
| Molecular Formula | C24H21F3N4O |
| Molecular Weight | 438.45 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | N-(2-bicyclo[2.2.1]hept-5-enyl)-N-methyl-4-[3-pyridin-3-yl-5-(trifluoromethyl)pyrazol-1-yl]benzamide |
| SMILES | CN(C(=O)c1ccc(-n2nc(-c3cccnc3)cc2C(F)(F)F)cc1)C1CC2C=CC1C2 |
| InChI | InChI=1S/C24H21F3N4O/c1-30(21-12-15-4-5-17(21)11-15)23(32)16-6-8-19(9-7-16)31-22(24(25,26)27)13-20(29-31)18-3-2-10-28-14-18/h2-10,13-15,17,21H,11-12H2,1H3 |
| InChIKey | BSOMNYVZZHLPEX-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.45 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|