C23H20F3N5O — CID 89354101
(2Z,4E)-2-amino-N-benzyl-5-[3-pyridin-3-yl-5-(trifluoromethyl)pyrazol-1-yl]hepta-2,4,6-trienamide (PubChem CID 89354101) has the molecular formula C23H20F3N5O and a molecular weight of 439.44 g/mol. Its IUPAC name is (2Z,4E)-2-amino-N-benzyl-5-[3-pyridin-3-yl-5-(trifluoromethyl)pyrazol-1-yl]hepta-2,4,6-trienamide.
| Compound Name | (2Z,4E)-2-amino-N-benzyl-5-[3-pyridin-3-yl-5-(trifluoromethyl)pyrazol-1-yl]hepta-2,4,6-trienamide |
|---|---|
| PubChem CID | 89354101 |
| Molecular Formula | C23H20F3N5O |
| Molecular Weight | 439.44 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | (2Z,4E)-2-amino-N-benzyl-5-[3-pyridin-3-yl-5-(trifluoromethyl)pyrazol-1-yl]hepta-2,4,6-trienamide |
| SMILES | C=C/C(=C\C=C(/N)C(=O)NCc1ccccc1)n1nc(-c2cccnc2)cc1C(F)(F)F |
| InChI | InChI=1S/C23H20F3N5O/c1-2-18(10-11-19(27)22(32)29-14-16-7-4-3-5-8-16)31-21(23(24,25)26)13-20(30-31)17-9-6-12-28-15-17/h2-13,15H,1,14,27H2,(H,29,32)/b18-10+,19-11- |
| InChIKey | VLOQDXNJGUODHS-PAUOAVIZSA-N |
| XLogP | 4.15 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.44 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|