C15H16F3N5 — CID 143484266
(Z)-N-methyl-4-methylimino-4-[3-pyridin-3-yl-5-(trifluoromethyl)pyrazol-1-yl]but-2-en-1-amine (PubChem CID 143484266) has the molecular formula C15H16F3N5 and a molecular weight of 323.32 g/mol. Its IUPAC name is (Z)-N-methyl-4-methylimino-4-[3-pyridin-3-yl-5-(trifluoromethyl)pyrazol-1-yl]but-2-en-1-amine.
| Compound Name | (Z)-N-methyl-4-methylimino-4-[3-pyridin-3-yl-5-(trifluoromethyl)pyrazol-1-yl]but-2-en-1-amine |
|---|---|
| PubChem CID | 143484266 |
| Molecular Formula | C15H16F3N5 |
| Molecular Weight | 323.32 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | (Z)-N-methyl-4-methylimino-4-[3-pyridin-3-yl-5-(trifluoromethyl)pyrazol-1-yl]but-2-en-1-amine |
| SMILES | C/N=C(\C=C/CNC)n1nc(-c2cccnc2)cc1C(F)(F)F |
| InChI | InChI=1S/C15H16F3N5/c1-19-7-4-6-14(20-2)23-13(15(16,17)18)9-12(22-23)11-5-3-8-21-10-11/h3-6,8-10,19H,7H2,1-2H3/b6-4-,20-14+ |
| InChIKey | MKTWTUKRRKPEAA-BTMWKBMXSA-N |
| XLogP | 2.62 |
| TPSA | 55.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.32 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|