C10H12FNO — CID 143484621
N-ethyl-4-fluorocyclohepta-1,3,5-triene-1-carboxamide (PubChem CID 143484621) has the molecular formula C10H12FNO and a molecular weight of 181.21 g/mol. Its IUPAC name is N-ethyl-4-fluorocyclohepta-1,3,5-triene-1-carboxamide.
| Compound Name | N-ethyl-4-fluorocyclohepta-1,3,5-triene-1-carboxamide |
|---|---|
| PubChem CID | 143484621 |
| Molecular Formula | C10H12FNO |
| Molecular Weight | 181.21 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | N-ethyl-4-fluorocyclohepta-1,3,5-triene-1-carboxamide |
| SMILES | CCNC(=O)C1=CC=C(F)C=CC1 |
| InChI | InChI=1S/C10H12FNO/c1-2-12-10(13)8-4-3-5-9(11)7-6-8/h3,5-7H,2,4H2,1H3,(H,12,13) |
| InChIKey | LRMNEAYRWLFNAN-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.21 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |