C18H25N3O4 — CID 143485175
2-[(4S)-4-[2-(4-ethylphenyl)ethyl]-2,5-dioxoimidazolidin-1-yl]-N-hydroxy-3-methylbutanamide (PubChem CID 143485175) has the molecular formula C18H25N3O4 and a molecular weight of 347.42 g/mol. Its IUPAC name is 2-[(4S)-4-[2-(4-ethylphenyl)ethyl]-2,5-dioxoimidazolidin-1-yl]-N-hydroxy-3-methylbutanamide.
| Compound Name | 2-[(4S)-4-[2-(4-ethylphenyl)ethyl]-2,5-dioxoimidazolidin-1-yl]-N-hydroxy-3-methylbutanamide |
|---|---|
| PubChem CID | 143485175 |
| Molecular Formula | C18H25N3O4 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | 2-[(4S)-4-[2-(4-ethylphenyl)ethyl]-2,5-dioxoimidazolidin-1-yl]-N-hydroxy-3-methylbutanamide |
| SMILES | CCc1ccc(CC[C@@H]2NC(=O)N(C(C(=O)NO)C(C)C)C2=O)cc1 |
| InChI | InChI=1S/C18H25N3O4/c1-4-12-5-7-13(8-6-12)9-10-14-17(23)21(18(24)19-14)15(11(2)3)16(22)20-25/h5-8,11,14-15,25H,4,9-10H2,1-3H3,(H,19,24)(H,20,22)/t14-,15?/m0/s1 |
| InChIKey | NWLXTTVQMMHIBQ-MLCCFXAWSA-N |
| XLogP | 1.63 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|